CAS 90779-69-4
:Atosiban
Description:
Atosiban is a synthetic peptide that functions as an oxytocin receptor antagonist, primarily used in obstetrics to inhibit premature labor. Its chemical structure is characterized by a sequence of amino acids that mimic the natural hormone oxytocin, allowing it to bind to the same receptors but block their activation. This action helps to relax uterine contractions, making it a valuable therapeutic agent in managing preterm labor. Atosiban is typically administered intravenously and has a relatively short half-life, necessitating careful monitoring during treatment. The substance is known for its specificity to the oxytocin receptor, which minimizes side effects compared to other tocolytic agents. In terms of solubility, atosiban is generally soluble in water, which facilitates its intravenous administration. Its pharmacokinetics and pharmacodynamics are well-studied, contributing to its clinical use in obstetric care. Overall, atosiban represents a targeted approach to managing preterm labor, with a focus on receptor-specific action to minimize adverse effects.
Formula:C43H67N11O12S2
InChI:InChI=1/C43H67N11O12S2/c1-5-23(3)35-41(63)53-36(24(4)55)42(64)50-29(20-32(45)56)38(60)51-30(43(65)54-17-8-10-31(54)40(62)49-27(9-7-16-44)37(59)47-21-33(46)57)22-68-67-18-15-34(58)48-28(39(61)52-35)19-25-11-13-26(14-12-25)66-6-2/h11-14,23-24,27-31,35-36,55H,5-10,15-22,44H2,1-4H3,(H2,45,56)(H2,46,57)(H,47,59)(H,48,58)(H,49,62)(H,50,64)(H,51,60)(H,52,61)(H,53,63)/t23-,24+,27-,28+,29-,30-,31-,35-,36?/m0/s1
Synonyms:- Atosiban [USAN:INN]
- Rwj 22164
- 1-(3-Mercaptopropionic acid)-2-(3-(p-ethoxyphenyl)-D-alanine)-4-L-threonine-8-L-ornithineoxytocin
- 1-Deamino-2D-tyr-(OEt)-4-thr-8-orn-oxytocin
- Atosibanum
- Atosibanum [INN-Latin]
- Orf 22164
- Tractocile
- Unii-081D12Si0Z
- Oxytocin, 1-(3-mercaptopropanoic acid)-2-(O-ethyl-D-tyrosine)-4-L-threonine-8-L-ornithine-
- 1-({(4R,7S,13S,16R)-7-(2-amino-2-oxoethyl)-13-[(2S)-butan-2-yl]-16-(4-ethoxybenzyl)-10-[(1R)-1-hydroxyethyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl}carbonyl)-L-prolyl-L-ornithylglycinamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Atosiban
CAS:Oxytocin/vasopressin receptor antagonist.Formula:C43H67N11O12S2Purity:99.4%Color and Shape:WhiteMolecular weight:994.2Atosiban
CAS:<p>Atosiban</p>Purity:99.2% by hplc (Typical Value in Batch COA)Color and Shape: sterile filtered white lyophilized (freeze-dried) powder.Molecular weight:994.19g/molAtosiban
CAS:Formula:C43H67N11O12S2Purity:≥ 98%Color and Shape:White to off-white powderMolecular weight:994.19Atosiban
CAS:<p>Atosiban (RW22164), an oxytocin/vasopressin inhibitor, halts premature labor as an intravenous tocolytic, reducing uterine contractions rapidly.</p>Formula:C43H67N11O12S2Purity:98%Color and Shape:SolidMolecular weight:994.19Atosiban Acetate
CAS:Formula:C43H67N11O12S2Purity:95%~99%Color and Shape:White to Off-white PowderMolecular weight:994.189




