CAS 90792-98-6

1-(3-chloro-4-methylphenyl)ethanone

Description:

1-(3-Chloro-4-methylphenyl)ethanone, also known by its CAS number 90792-98-6, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. This compound features a chloro group and a methyl group on the aromatic ring, which influences its chemical reactivity and physical properties. Typically, it appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the chloro substituent can enhance its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Its molecular structure contributes to its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, like many chlorinated compounds, it may exhibit specific environmental and health considerations, necessitating careful handling and disposal. Overall, 1-(3-chloro-4-methylphenyl)ethanone is a valuable compound in synthetic organic chemistry, with properties that facilitate its use in diverse chemical applications.

Formula: C₉H₉ClO

InChI: InChI=1/C9H9ClO/c1-6-3-4-8(7(2)11)5-9(6)10/h3-5H,1-2H3

SMILES: Cc1ccc(cc1Cl)C(=O)C

Synonyms:

• Ethanone, 1-(3-Chloro-4-Methylphenyl)-

Ethanone, 1-(3-chloro-4-methylphenyl)-

CAS: 90792-98-6

Formula: C₉H₉ClO

Purity: 98%

Color and Shape: Solid

Molecular weight: 168.6202

Ref: IN-DA00IGAE

3-Chloro-4-methylacetophenone

CAS: 90792-98-6

3-Chloro-4-methylacetophenone

Purity: 98%

Molecular weight: 168.62g/mol

Ref: 54-OR1036190

3′-Chloro-4′-methylacetophenone

CAS: 90792-98-6

Formula: C₉H₉ClO

Purity: 98%

Color and Shape: Oil

Molecular weight: 168.62

Ref: 10-F398353

3-Chloro-4-methylacetophenone

CAS: 90792-98-6

3-Chloro-4-methylacetophenone is an acetophenone with a molecular weight of 149.3 g/mol and a melting point of -98°C. It has an acyl group with the molecular weight of 126.2 g/mol. 3-Chloro-4-methylacetophenone is soluble in ethanol, ether, benzene, chloroform, carbon tetrachloride and ethyl acetate. 3-Chloro-4-methylacetophenone is used as a solvent for cellulose nitrate, phenolic compounds and resins.

Formula: C₉H₉ClO

Purity: Min. 95%

Molecular weight: 168.62 g/mol

Ref: 3D-QDA79298