CAS 90793-96-7

2-chloro-N-[(1R)-1-(3,4-dichlorophenyl)ethyl]acetamide

Description:

2-chloro-N-[(1R)-1-(3,4-dichlorophenyl)ethyl]acetamide, with the CAS number 90793-96-7, is a chemical compound characterized by its specific structural features. It contains a chloro group and an acetamide functional group, which contribute to its reactivity and potential biological activity. The presence of the 3,4-dichlorophenyl moiety suggests that it may exhibit significant lipophilicity, influencing its solubility and interaction with biological membranes. The compound's stereochemistry, indicated by the (1R) configuration, may play a crucial role in its pharmacological properties, potentially affecting its binding affinity to biological targets. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods such as NMR, IR spectroscopy, and mass spectrometry. Safety and handling precautions should be observed due to the presence of chlorine atoms, which can pose health risks.

Formula: C₁₀H₁₀Cl₃NO

InChI: InChI=1/C10H10Cl3NO/c1-6(14-10(15)5-11)7-2-3-8(12)9(13)4-7/h2-4,6H,5H2,1H3,(H,14,15)/t6-/m1/s1

SMILES: C[C@H](c1ccc(c(c1)Cl)Cl)N=C(CCl)O

2-Chloro-N-[1-(3,4-dichlorophenyl)ethyl]acetamide

CAS: 90793-96-7

Versatile small molecule scaffold

Formula: C₁₀H₁₀Cl₃NO

Purity: Min. 95%

Molecular weight: 266.5 g/mol

Ref: 3D-QDA79396