CAS 907958-42-3

4-chloro-5-nitro-1H-indazole

Description:

4-Chloro-5-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 4-position and a nitro group at the 5-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in various fields, including medicinal chemistry, due to its potential biological activity. The nitro group can serve as a site for further chemical modifications, making it a valuable intermediate in synthetic chemistry. Additionally, the presence of halogen and nitro substituents can influence the compound's electronic properties, potentially affecting its interactions with biological targets. Safety data should be consulted, as compounds with halogen and nitro groups can pose health risks and environmental concerns. Overall, 4-chloro-5-nitro-1H-indazole is a compound of interest for research and development in chemical and pharmaceutical applications.

Formula: C₇H₄ClN₃O₂

InChI: InChI=1/C7H4ClN3O2/c8-7-4-3-9-10-5(4)1-2-6(7)11(12)13/h1-3H,(H,9,10)

SMILES: c1cc(c(c2c[nH]nc12)Cl)N(=O)=O

Synonyms:

• 4-CHLORO-5-NITRO-(1H)INDAZOLE
• 1H-Indazole, 4-chloro-5-nitro-

4-Chloro-5-nitro-1H-indazole

CAS: 907958-42-3

Formula: C₇H₄ClN₃O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 197.5786

Ref: IN-DA006AGS

4-Chloro-5-nitro-1H-indazole

CAS: 907958-42-3

4-Chloro-5-nitro-1H-indazole

Purity: 96%

Molecular weight: 197.58g/mol

Ref: 54-OR92648

4-CHLORO-5-NITRO-1H-INDAZOLE

CAS: 907958-42-3

Purity: 96%

Molecular weight: 197.5800018

Ref: 10-F857034

4-Chloro-5-nitro-1H-indazole

CAS: 907958-42-3

Formula: C₇H₄ClN₃O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 197.58

Ref: 10-F335088

4-chloro-5-nitro-1h-indazole

CAS: 907958-42-3

Versatile small molecule scaffold

Formula: C₇H₄ClN₃O₂

Purity: Min. 95%

Molecular weight: 197.58 g/mol

Ref: 3D-HLB95842