CymitQuimica logo

CAS 907972-78-5

:

4-Methoxy-3-[[(3-methyl-1H-1,2,4-triazol-5-yl)thio]methyl]benzaldehyde

Description:
4-Methoxy-3-[[(3-methyl-1H-1,2,4-triazol-5-yl)thio]methyl]benzaldehyde is an organic compound characterized by its complex structure, which includes a methoxy group, a triazole moiety, and an aldehyde functional group. The presence of the methoxy group contributes to its solubility in organic solvents and may influence its reactivity and biological activity. The triazole ring is known for its stability and is often involved in various biological applications, including as a pharmacophore in medicinal chemistry. The thioether linkage between the triazole and the benzaldehyde enhances the compound's potential for interactions with biological targets. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential for diverse applications in drug development, particularly in the design of novel therapeutic agents. As with many organic compounds, its physical properties, such as melting point and solubility, would depend on the specific conditions and purity of the sample.
Formula:C12H13N3O2S
InChI:InChI=1S/C12H13N3O2S/c1-8-13-12(15-14-8)18-7-10-5-9(6-16)3-4-11(10)17-2/h3-6H,7H2,1-2H3,(H,13,14,15)
InChI key:InChIKey=PHMCQZALJLXCQS-UHFFFAOYSA-N
SMILES:C(SC1=NN=C(C)N1)C2=C(OC)C=CC(C=O)=C2
Synonyms:
  • Benzaldehyde, 4-methoxy-3-[[(3-methyl-1H-1,2,4-triazol-5-yl)thio]methyl]-
  • 4-Methoxy-3-[[(3-methyl-1H-1,2,4-triazol-5-yl)thio]methyl]benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.