
CAS 907973-10-8
:5-[(Methylthio)methyl]-2-piperazinone
Description:
5-[(Methylthio)methyl]-2-piperazinone is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a methylthio group, which is a sulfur-containing functional group, attached to a methylene bridge that connects to the piperazinone structure. The presence of the methylthio group can influence the compound's solubility, reactivity, and biological activity. Typically, piperazinones are known for their potential pharmacological properties, including activity as anxiolytics, antidepressants, or antipsychotics. The molecular structure suggests that it may exhibit polar characteristics due to the nitrogen and sulfur atoms, which can affect its interactions in biological systems. Additionally, the compound's CAS number, 907973-10-8, allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in research or industry. Overall, 5-[(Methylthio)methyl]-2-piperazinone represents a unique structure that may be of interest in medicinal chemistry and drug development.
Formula:C6H12N2OS
InChI:InChI=1S/C6H12N2OS/c1-10-4-5-2-8-6(9)3-7-5/h5,7H,2-4H2,1H3,(H,8,9)
InChI key:InChIKey=GLHUURKZOBJGTM-UHFFFAOYSA-N
SMILES:C(SC)C1CNC(=O)CN1
Synonyms:- 5-[(Methylthio)methyl]-2-piperazinone
- 2-Piperazinone, 5-[(methylthio)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.