
CAS 907973-48-2
:5,6-Difluoro-1,2,3,4-tetrahydro-1-naphthalenamine
Description:
5,6-Difluoro-1,2,3,4-tetrahydro-1-naphthalenamine, with the CAS number 907973-48-2, is a chemical compound characterized by its unique structure, which includes a naphthalene ring system that is partially saturated and substituted with two fluorine atoms at the 5 and 6 positions, as well as an amine functional group. This compound is typically a solid at room temperature and may exhibit properties such as moderate solubility in organic solvents. The presence of fluorine atoms often imparts enhanced stability and lipophilicity, which can influence its reactivity and biological activity. The amine group can participate in hydrogen bonding, making it potentially useful in various chemical reactions, including those in medicinal chemistry. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in drug development. As with many fluorinated compounds, it is essential to consider its environmental impact and toxicity profile during handling and application.
Formula:C10H11F2N
InChI:InChI=1S/C10H11F2N/c11-8-5-4-6-7(10(8)12)2-1-3-9(6)13/h4-5,9H,1-3,13H2
InChI key:InChIKey=CREDSYGNTQWQGH-UHFFFAOYSA-N
SMILES:FC1=C2C(C(N)CCC2)=CC=C1F
Synonyms:- 1-Naphthalenamine, 5,6-difluoro-1,2,3,4-tetrahydro-
- 5,6-Difluoro-1,2,3,4-tetrahydro-1-naphthalenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.