CAS 90799-81-8

6-chloro-2-phenylpyrimidin-4-amine

Description:

6-Chloro-2-phenylpyrimidin-4-amine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 6-position and a phenyl group at the 2-position contributes to its unique reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocyclic compounds. Its amine functional group at the 4-position can participate in hydrogen bonding, influencing its interactions in biological systems. Due to its structural features, 6-chloro-2-phenylpyrimidin-4-amine may exhibit pharmacological properties, making it of interest in medicinal chemistry for the development of therapeutic agents. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₈ClN₃

InChI: InChI=1/C10H8ClN3/c11-8-6-9(12)14-10(13-8)7-4-2-1-3-5-7/h1-6H,(H2,12,13,14)

Synonyms:

• 4-Pyrimidinamine, 6-chloro-2-phenyl-
• 6-chloro-2-phenylpyrimidin-4-amine

6-Chloro-2-phenylpyrimidin-4-amine

CAS: 90799-81-8

6-Chloro-2-phenylpyrimidin-4-amine

Purity: 95%

Molecular weight: 205.65g/mol

Ref: 54-OR1052688