CAS 908007-24-9
:ethyl 2-[5-(4-acetamidophenyl)-1H-imidazol-2-yl]acetate
Description:
Ethyl 2-[5-(4-acetamidophenyl)-1H-imidazol-2-yl]acetate is a chemical compound characterized by its complex structure, which includes an imidazole ring and an acetamidophenyl group. This compound typically exhibits properties associated with both its ester functional group and the presence of the imidazole moiety, which can contribute to its biological activity. Ethyl esters are generally known for their volatility and solubility in organic solvents, while imidazole derivatives often display pharmacological properties, including antimicrobial and antifungal activities. The presence of the acetamide group may enhance solubility and bioavailability. The compound's molecular interactions can be influenced by hydrogen bonding and π-π stacking due to the aromatic rings. Its potential applications may lie in medicinal chemistry, particularly in drug development, where such compounds are explored for therapeutic effects. As with many organic compounds, stability, reactivity, and solubility can vary based on environmental conditions and the presence of other substances.
Formula:C15H17N3O3
InChI:InChI=1/C15H17N3O3/c1-3-21-15(20)8-14-16-9-13(18-14)11-4-6-12(7-5-11)17-10(2)19/h4-7,9H,3,8H2,1-2H3,(H,16,18)(H,17,19)
SMILES:CCOC(=O)Cc1ncc(c2ccc(cc2)N=C(C)O)[nH]1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.