CAS 90801-36-8
:N,N-dimethyl-N'-4H-1,2,4-triazol-4-ylimidoformamide
Description:
N,N-Dimethyl-N'-4H-1,2,4-triazol-4-ylimidoformamide, with the CAS number 90801-36-8, is a chemical compound that features a triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound is characterized by its imidoformamide functional group, which contributes to its potential reactivity and biological activity. The presence of dimethyl groups indicates that it has two methyl substituents on the nitrogen atom, which can influence its solubility and interaction with biological systems. Typically, compounds like this may exhibit properties such as antimicrobial or antifungal activity, making them of interest in pharmaceutical and agricultural applications. Additionally, the specific arrangement of atoms and functional groups can affect its stability, polarity, and overall chemical behavior. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding, which can further influence its interactions in various environments. Safety and handling considerations should be taken into account, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C5H9N5
InChI:InChI=1/C5H9N5/c1-9(2)5-8-10-3-6-7-4-10/h3-5H,1-2H3
SMILES:CN(C)C=Nn1cnnc1
Synonyms:- N,N-dimethyl-N'-(4H-1,2,4-triazol-4-yl)iminoformamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(E)-N,N-Dimethyl-N'-(4H-1,2,4-triazol-4-yl)methanimidamide
CAS:(E)-N,N-Dimethyl-N'-(4H-1,2,4-triazol-4-yl)methanimidamidePurity:techMolecular weight:139.16g/mol
