CymitQuimica logo

CAS 90811-11-3

:

3-Pyridinesulfonamide, 2-(4-morpholinyl)-

Description:
3-Pyridinesulfonamide, 2-(4-morpholinyl)- is a chemical compound characterized by its pyridine and sulfonamide functional groups, which contribute to its biological activity and solubility properties. The presence of the morpholine ring enhances its potential as a pharmacological agent, often influencing its interaction with biological targets. This compound typically exhibits moderate to high polarity due to the sulfonamide group, which can engage in hydrogen bonding, affecting its solubility in various solvents. It may also display specific reactivity patterns, making it useful in medicinal chemistry for developing therapeutic agents. The molecular structure allows for potential interactions with enzymes or receptors, which is crucial for its application in drug design. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-Pyridinesulfonamide, 2-(4-morpholinyl)- is of interest in research and development, particularly in the fields of pharmaceuticals and biochemistry.
Formula:C9H13N3O3S
InChI:InChI=1S/C9H13N3O3S/c10-16(13,14)8-2-1-3-11-9(8)12-4-6-15-7-5-12/h1-3H,4-7H2,(H2,10,13,14)
InChI key:InChIKey=WEDUPJFHIKEMKS-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=C(N=CC=C1)N2CCOCC2
Synonyms:
  • 2-(Morpholin-4-yl)pyridine-3-sulfonamide
  • 3-Pyridinesulfonamide, 2-(4-morpholinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.