CymitQuimica logo

CAS 90812-24-1

:

3-(1-aminoethyl)tricyclo[3.3.1.1~3,7~]decan-1-ol

Description:
3-(1-aminoethyl)tricyclo[3.3.1.1^3,7]decan-1-ol, with the CAS number 90812-24-1, is a bicyclic organic compound characterized by its complex tricyclic structure. This compound features a hydroxyl group (-OH) at the first position of the tricyclic framework, which contributes to its potential as an alcohol. The presence of the aminoethyl group indicates that it has basic properties, allowing it to participate in various chemical reactions, including those typical of amines. The tricyclic structure provides rigidity and can influence the compound's physical properties, such as solubility and melting point. Additionally, the stereochemistry of the compound may play a significant role in its biological activity, making it of interest in medicinal chemistry. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis. However, specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.
Formula:C12H21NO
InChI:InChI=1/C12H21NO/c1-8(13)11-3-9-2-10(4-11)6-12(14,5-9)7-11/h8-10,14H,2-7,13H2,1H3
SMILES:CC(C12CC3CC(C1)CC(C3)(C2)O)N
Synonyms:
  • Tricyclo[3.3.1.1~3,7~]Decan-1-Ol, 3-(1-Aminoethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.