CAS 90814-91-8
:7-Bromo-2H-1,4-benzothiazin-3(4H)-one
Description:
7-Bromo-2H-1,4-benzothiazin-3(4H)-one is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a benzene ring and a thiazine moiety. This compound features a bromine substituent at the 7-position, which can influence its reactivity and biological activity. The presence of the thiazine ring contributes to its potential as a pharmacophore in medicinal chemistry, often associated with various biological activities, including antimicrobial and anti-inflammatory properties. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and the presence of other functional groups. As with many brominated compounds, it may also exhibit unique electronic properties due to the halogen's electronegativity. Safety data should be consulted for handling, as brominated compounds can pose health risks. Overall, 7-Bromo-2H-1,4-benzothiazin-3(4H)-one is of interest in both synthetic and medicinal chemistry contexts.
Formula:C8H6BrNOS
InChI:InChI=1/C8H6BrNOS/c9-5-1-2-6-7(3-5)12-4-8(11)10-6/h1-3H,4H2,(H,10,11)
SMILES:c1cc2c(cc1Br)SCC(=N2)O
Synonyms:- 2H-1,4-benzothiazin-3(4H)-one, 7-bromo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Bromo-2H-1,4-benzothiazin-3(4H)-one
CAS:Formula:C8H6BrNOSPurity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:244.117-Bromo-2H-1,4-benzothiazin-3(4H)-one, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H6BrNOSPurity:97%Color and Shape:white to cream, PowderMolecular weight:244.117-Bromo-2H-benzo[b][1,4]thiazin-3(4H)-one
CAS:Formula:C8H6BrNOSPurity:97%Color and Shape:SolidMolecular weight:244.10837-Bromo-2H-benzo[b][1,4]thiazin-3(4H)-one
CAS:7-Bromo-2H-benzo[b][1,4]thiazin-3(4H)-onePurity:98%Molecular weight:244.11g/mol




