CAS 90815-00-2
:1-(2-chlorobenzyl)-1H-indole-3-carbaldehyde
Description:
1-(2-Chlorobenzyl)-1H-indole-3-carbaldehyde, with the CAS number 90815-00-2, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a chlorobenzyl group at the 1-position and an aldehyde functional group at the 3-position of the indole moiety. The presence of the chlorine atom introduces a degree of polarity and can influence the compound's reactivity and solubility. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The aldehyde group is reactive, allowing for various chemical transformations, such as condensation reactions. Additionally, the compound may display fluorescence properties, which can be useful in various applications, including imaging and sensing. Overall, 1-(2-chlorobenzyl)-1H-indole-3-carbaldehyde is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C16H12ClNO
InChI:InChI=1/C16H12ClNO/c17-15-7-3-1-5-12(15)9-18-10-13(11-19)14-6-2-4-8-16(14)18/h1-8,10-11H,9H2
SMILES:c1ccc(c(c1)Cn1cc(C=O)c2ccccc12)Cl
Synonyms:- 1H-Indole-3-carboxaldehyde, 1-[(2-chlorophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
