CAS 90817-19-9

3-(Methylamino)benzamide

Description:

3-(Methylamino)benzamide is an organic compound characterized by the presence of a benzamide functional group with a methylamino substituent at the meta position of the aromatic ring. Its molecular structure consists of a benzene ring attached to a carbonyl group (amide) and an amino group with a methyl group. This compound typically exhibits properties such as being a solid at room temperature, with moderate solubility in polar solvents due to the presence of the amide and amino groups, which can engage in hydrogen bonding. The presence of the methylamino group can influence its reactivity and biological activity, making it of interest in medicinal chemistry and drug design. Additionally, the compound may exhibit basic properties due to the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and acylation. Its specific applications and behavior can vary based on the context of use, including potential roles in pharmaceuticals or as a chemical intermediate. Safety data should be consulted for handling and usage guidelines.

Formula: C₈H₁₀N₂O

InChI: InChI=1S/C8H10N2O/c1-10-7-4-2-3-6(5-7)8(9)11/h2-5,10H,1H3,(H2,9,11)

InChI key: InChIKey=NZZZOYVRPOWZJQ-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=CC(NC)=CC=C1

Synonyms:

• 3-(Methylamino)benzamide
• 3-Methylaminobenzamide
• Benzamide, 3-(methylamino)-