CAS 90817-87-1

5,6,7-trimethyl-2,6-dihydro-1H-pyrrolo[3,4-d]pyridazin-1-one

Description:

5,6,7-trimethyl-2,6-dihydro-1H-pyrrolo[3,4-d]pyridazin-1-one, with the CAS number 90817-87-1, is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both pyrrole and pyridazine moieties. This compound features three methyl groups at the 5, 6, and 7 positions, contributing to its hydrophobic characteristics and potentially influencing its biological activity. The presence of the dihydro group indicates that it is a saturated derivative, which may affect its reactivity and stability compared to fully unsaturated analogs. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of nitrogen atoms that can participate in various chemical interactions. Additionally, its unique arrangement of functional groups may confer specific properties such as solubility and binding affinity, making it of interest for further research in drug design and development. However, detailed studies on its biological activity and toxicity would be necessary to fully understand its potential applications.

Formula: C₉H₁₁N₃O

InChI: InChI=1/C9H11N3O/c1-5-7-4-10-11-9(13)8(7)6(2)12(5)3/h4H,1-3H3,(H,11,13)

SMILES: Cc1c2cnnc(c2c(C)n1C)O