CAS 908240-50-6

2,4-Dichloropyrido[3,4-d]pyrimidine

Description:

2,4-Dichloropyrido[3,4-d]pyrimidine is a heterocyclic compound characterized by its fused pyridine and pyrimidine rings, which incorporate two chlorine substituents at the 2 and 4 positions. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential applications in medicinal chemistry, particularly as a scaffold for developing bioactive molecules. The presence of chlorine atoms enhances its reactivity and can influence its biological activity. The compound is soluble in organic solvents, but its solubility in water is limited. Its molecular structure contributes to its stability and reactivity, making it a subject of interest in various chemical synthesis and pharmaceutical research. Additionally, 2,4-Dichloropyrido[3,4-d]pyrimidine may exhibit specific interactions with biological targets, which can be explored for therapeutic purposes. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₃Cl₂N₃

InChI: InChI=1/C7H3Cl2N3/c8-6-4-1-2-10-3-5(4)11-7(9)12-6/h1-3H

SMILES: c1cncc2c1c(Cl)nc(Cl)n2

2,4-Dichloropyrido[3,4-d]pyrimidine

CAS: 908240-50-6

Formula: C₇H₃Cl₂N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 200.0248

Ref: IN-DA0036XX

2,4-Dichloropyrido[3,4-d]pyrimidine

CAS: 908240-50-6

2,4-Dichloropyrido[3,4-d]pyrimidine

Purity: 95%

Color and Shape: Solid

Molecular weight: 200.02g/mol

Ref: 54-OR301218

2,4-Dichloropyrido[3,4-d]pyrimidine

CAS: 908240-50-6

Formula: C₇H₃Cl₂N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 200.02

Ref: 10-F230531