CAS 908245-26-1
:1,3-Diazidotricyclo[3.3.1.13,7]decane
Description:
1,3-Diazidotricyclo[3.3.1.1^3,7]decane is a nitrogen-rich organic compound characterized by its unique tricyclic structure and the presence of azide functional groups. The compound features a bicyclic framework that contributes to its stability and potential reactivity. The azide groups (-N3) are known for their energetic properties, making this compound of interest in the field of materials science and energetic materials. Its molecular structure allows for various applications, particularly in the development of propellants and explosives, due to the high nitrogen content which can lead to the release of energy upon decomposition. Additionally, the compound may exhibit interesting physical properties such as high density and sensitivity to heat or shock, which are typical of azide-containing compounds. Safety precautions are essential when handling such materials, as they can be hazardous. Overall, 1,3-Diazidotricyclo[3.3.1.1^3,7]decane represents a fascinating subject for research in both synthetic chemistry and energetic material applications.
Formula:C10H14N6
InChI:InChI=1S/C10H14N6/c11-15-13-9-2-7-1-8(4-9)5-10(3-7,6-9)14-16-12/h7-8H,1-6H2
InChI key:InChIKey=VYTTZRCUSZBQTC-UHFFFAOYSA-N
SMILES:N(=[N+]=[N-])C12CC3(N=[N+]=[N-])CC(C1)CC(C2)C3
Synonyms:- 1,3-Diazidoadamantane
- Tricyclo[3.3.1.13,7]decane, 1,3-diazido-
- 1,3-Diazidotricyclo[3.3.1.13,7]decane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3-Diazidoadamantane
CAS:Controlled ProductFormula:C10H14N6Color and Shape:NeatMolecular weight:218.258
