CAS 908247-64-3

3,4-Dihydro-2,2-dimethyl-2H-1,4-benzoxazin-7-amine

Description:

3,4-Dihydro-2,2-dimethyl-2H-1,4-benzoxazin-7-amine is a chemical compound characterized by its unique bicyclic structure, which includes a benzoxazine ring fused with a saturated dihydro moiety. This compound features a dimethyl substitution at the 2-position of the benzoxazine, contributing to its steric and electronic properties. The presence of an amine group at the 7-position enhances its potential for hydrogen bonding and reactivity, making it of interest in various chemical applications, including medicinal chemistry and materials science. The compound's structure suggests potential biological activity, which may be explored in pharmacological studies. Additionally, its stability and solubility characteristics can vary based on the surrounding environment, influencing its behavior in different chemical contexts. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the amine functional group, which can be reactive. Overall, 3,4-Dihydro-2,2-dimethyl-2H-1,4-benzoxazin-7-amine represents a versatile structure with potential applications in various fields of research.

Formula: C₁₀H₁₄N₂O

InChI: InChI=1S/C10H14N2O/c1-10(2)6-12-8-4-3-7(11)5-9(8)13-10/h3-5,12H,6,11H2,1-2H3

InChI key: InChIKey=JHYQLUYATPQPGT-UHFFFAOYSA-N

SMILES: CC1(C)OC=2C(NC1)=CC=C(N)C2

Synonyms:

• 2,2-Dimethyl-3,4-dihydro-2H-benzo[b][1,4]oxazin-7-amine
• 3,4-Dihydro-2,2-dimethyl-2H-1,4-benzoxazin-7-amine
• 2H-1,4-Benzoxazin-7-amine, 3,4-dihydro-2,2-dimethyl-
• 2,2-Dimethyl-3,4-dihydro-1,4-benzoxazin-7-amine