CAS 908248-87-3
:3,5-dimethyl-4H-isoxazole-5-carboxylic acid
Description:
3,5-Dimethyl-4H-isoxazole-5-carboxylic acid is a heterocyclic organic compound characterized by its isoxazole ring structure, which consists of a five-membered ring containing three carbon atoms, one nitrogen atom, and one oxygen atom. The presence of two methyl groups at the 3 and 5 positions contributes to its hydrophobic characteristics, while the carboxylic acid functional group at the 5 position imparts acidic properties. This compound is typically used in pharmaceutical research and development due to its potential biological activity. It may exhibit properties such as anti-inflammatory or antimicrobial effects, although specific biological activities can vary based on structural modifications and the presence of substituents. The compound is generally soluble in polar solvents, which is common for carboxylic acids, and its stability can be influenced by environmental factors such as pH and temperature. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C6H9NO3
InChI:InChI=1/C6H9NO3/c1-4-3-6(2,5(8)9)10-7-4/h3H2,1-2H3,(H,8,9)
SMILES:CC1=NOC(C)(C1)C(=O)O
Synonyms:- 3,5-Dimethyl-4,5-Dihydro-1,2-Oxazole-5-Carboxylic Acid
- 5-Isoxazolecarboxylic Acid, 4,5-Dihydro-3,5-Dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
