CAS 90825-50-6
:diethyl 2,4-dicyanopentanedioate
Description:
Diethyl 2,4-dicyanopentanedioate, with the CAS number 90825-50-6, is an organic compound characterized by its structure, which includes two ethyl ester groups and two cyano groups attached to a pentanedioate backbone. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity due to the presence of the cyano groups, which can participate in various chemical reactions, including nucleophilic additions and polymerization processes. The compound is soluble in organic solvents, making it useful in organic synthesis and as an intermediate in the production of other chemicals. Additionally, diethyl 2,4-dicyanopentanedioate may exhibit biological activity, although specific toxicity and safety data should be consulted for handling and usage. Its applications can extend to fields such as pharmaceuticals, agrochemicals, and materials science, where it may serve as a building block for more complex molecules.
Formula:C11H14N2O4
InChI:InChI=1/C11H14N2O4/c1-3-16-10(14)8(6-12)5-9(7-13)11(15)17-4-2/h8-9H,3-5H2,1-2H3
Synonyms:- pentanedioic acid, 2,4-dicyano-, diethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
