CAS 908266-45-5
:Tropine-3-xanthate
Description:
Tropine-3-xanthate, identified by its CAS number 908266-45-5, is a chemical compound that belongs to the class of xanthates, which are esters of xanthic acid. This substance is characterized by its unique structure, which includes a tropine moiety—a bicyclic structure derived from tropane—attached to a xanthate functional group. Xanthates are known for their role as collectors in the flotation process in mineral processing, as well as their applications in organic synthesis. Tropine-3-xanthate may exhibit properties such as solubility in organic solvents, and its reactivity can be influenced by the presence of the xanthate group, which can undergo various chemical transformations. Additionally, the compound's stability, toxicity, and environmental impact would depend on its specific formulation and usage conditions. As with many xanthates, safety precautions should be taken when handling this compound due to potential hazards associated with its chemical nature. Further studies would be necessary to fully elucidate its properties and applications in various fields.
Formula:C9H15NOS2
InChI:InChI=1/C9H15NOS2/c1-10-6-2-3-7(10)5-8(4-6)13-9(11)12/h6-8H,2-5H2,1H3,(H,11,12)
SMILES:CN1C2CCC1CC(C2)SC(=O)S
Synonyms:- Carbonodithioic acid S-[(3-exo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] ester
- S-(8-methyl-8-azabicyclo[3.2.1]oct-3-yl) hydrogen carbonodithioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.