
CAS 908269-58-9
:4-(2-Amino-5-thiazolyl)tetrahydro-2H-pyran-4-ol
Description:
4-(2-Amino-5-thiazolyl)tetrahydro-2H-pyran-4-ol, identified by its CAS number 908269-58-9, is a chemical compound characterized by its unique structural features, which include a tetrahydropyran ring and a thiazole moiety. This compound typically exhibits properties such as solubility in polar solvents, which is common for compounds containing hydroxyl and amino functional groups. The presence of the thiazole ring contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and bioactive molecules. The amino group can participate in hydrogen bonding, enhancing its reactivity and interaction with biological targets. Additionally, the compound may display moderate stability under standard conditions, although specific stability and reactivity can depend on environmental factors such as pH and temperature. Overall, this compound's structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C8H12N2O2S
InChI:InChI=1S/C8H12N2O2S/c9-7-10-5-6(13-7)8(11)1-3-12-4-2-8/h5,11H,1-4H2,(H2,9,10)
InChI key:InChIKey=REIGYWLLOSRIOV-UHFFFAOYSA-N
SMILES:OC1(CCOCC1)C2=CN=C(N)S2
Synonyms:- 4-(2-Amino-5-thiazolyl)tetrahydro-2H-pyran-4-ol
- 2H-Pyran-4-ol, 4-(2-amino-5-thiazolyl)tetrahydro-
- 4-(2-Aminothiazol-5-yl)tetrahydropyran-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.