CAS 908271-40-9
:3-(3-Furanyl)-1H-pyrazole-4-methanol
Description:
3-(3-Furanyl)-1H-pyrazole-4-methanol is an organic compound characterized by its unique structural features, which include a pyrazole ring and a furan moiety. The presence of the furan ring contributes to its aromatic properties, while the pyrazole structure is known for its diverse biological activities. This compound typically exhibits moderate solubility in polar solvents due to the hydroxymethyl group (-CH2OH) attached to the pyrazole, which can engage in hydrogen bonding. The compound may display interesting reactivity patterns, making it a candidate for various synthetic applications in medicinal chemistry and material science. Its potential biological activities could be explored in pharmacological studies, particularly in relation to anti-inflammatory or antimicrobial properties. As with many organic compounds, the stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-(3-Furanyl)-1H-pyrazole-4-methanol represents a versatile structure with potential applications in research and industry.
Formula:C8H8N2O2
InChI:InChI=1S/C8H8N2O2/c11-4-7-3-9-10-8(7)6-1-2-12-5-6/h1-3,5,11H,4H2,(H,9,10)
InChI key:InChIKey=SOUCZQYNYUELKY-UHFFFAOYSA-N
SMILES:C(O)C=1C(=NNC1)C=2C=COC2
Synonyms:- [3-(Furan-3-yl)-1H-pyrazol-4-yl]methanol
- 3-(3-Furanyl)-1H-pyrazole-4-methanol
- 1H-Pyrazole-4-methanol, 3-(3-furanyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.