CAS 908355-84-0
:7-chloro[1,3]thiazolo[4,5-c]pyridine-2(3H)-thione
Description:
7-Chloro[1,3]thiazolo[4,5-c]pyridine-2(3H)-thione is a heterocyclic compound characterized by its unique structural features, which include a thiazole ring fused to a pyridine moiety. This compound contains a chlorine atom at the 7-position and a thione functional group at the 2-position, contributing to its reactivity and potential biological activity. The presence of sulfur in the thiazole ring and the thione group enhances its chemical properties, making it a candidate for various applications in medicinal chemistry and material science. The compound is likely to exhibit specific solubility characteristics, stability under certain conditions, and potential interactions with biological targets, which can be explored further in pharmacological studies. Its CAS number, 908355-84-0, allows for easy identification and retrieval of data related to its synthesis, properties, and applications in scientific literature. Overall, this compound represents a class of thiazole and pyridine derivatives that are of interest for their diverse chemical behavior and potential utility in various fields.
Formula:C6H3ClN2S2
InChI:InChI=1/C6H3ClN2S2/c7-3-1-8-2-4-5(3)11-6(10)9-4/h1-2H,(H,9,10)
SMILES:c1c(c2c(cn1)nc(S)s2)Cl
Synonyms:- 7-Chloro[1,3]thiazolo[4,5-c]pyridine-2-thiol
- Thiazolo[4,5-C]Pyridine-2-Thiol, 7-Chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
