CAS 90837-23-3
:YL 6121
Description:
YL 6121, identified by the CAS number 90837-23-3, is a chemical substance that falls under the category of polymeric materials, specifically a type of silicone compound. It is characterized by its unique properties, including excellent thermal stability, chemical resistance, and flexibility, making it suitable for various applications in industries such as automotive, electronics, and personal care. YL 6121 typically exhibits low surface tension, which enhances its ability to spread and wet surfaces effectively. Additionally, it may possess hydrophobic characteristics, contributing to its utility in water-repellent formulations. The substance is often used as an additive in formulations to improve texture, enhance gloss, and provide a smooth finish. Safety data sheets for YL 6121 would provide specific handling and storage guidelines, emphasizing the importance of following safety protocols due to potential health and environmental considerations. Overall, YL 6121 is valued for its multifunctional properties that enhance the performance of various products.
Formula:(C18H18O4)x
InChI:InChI=1S/C18H18O4/c1-5-15(19-9-17-11-21-17)6-2-13(1)14-3-7-16(8-4-14)20-10-18-12-22-18/h1-8,17-18H,9-12H2
InChI key:InChIKey=OZRVXYJWUUMVOW-UHFFFAOYSA-N
SMILES:O(CC1CO1)C2=CC=C(C=C2)C3=CC=C(OCC4CO4)C=C3
Synonyms:- Oxirane, 2,2′-[[1,1′-biphenyl]-4,4′-diylbis(oxymethylene)]bis-, homopolymer
- 4,4′-Biphenyl diglycidyl ether homopolymer
- BBG
- Epikote YL 6121
- YL 6121
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
