CAS 90841-17-1
:2-Bromo-N-(4-chlorophenyl)butanamide
Description:
2-Bromo-N-(4-chlorophenyl)butanamide is an organic compound characterized by its amide functional group, which is derived from butanoic acid. The presence of a bromine atom at the second carbon position and a 4-chlorophenyl group attached to the nitrogen atom significantly influences its chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic aromatic ring and polar amide group. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in synthetic organic chemistry. The presence of halogens, such as bromine and chlorine, can enhance its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's structure suggests potential for interactions with biological targets, which could be explored in drug discovery. Safety and handling precautions should be observed due to the presence of halogenated compounds, which may pose environmental and health risks.
Formula:C10H11BrClNO
InChI:InChI=1S/C10H11BrClNO/c1-2-9(11)10(14)13-8-5-3-7(12)4-6-8/h3-6,9H,2H2,1H3,(H,13,14)
InChI key:InChIKey=VMUDHGWIJGIWSI-UHFFFAOYSA-N
SMILES:N(C(C(CC)Br)=O)C1=CC=C(Cl)C=C1
Synonyms:- Butanamide, 2-bromo-N-(4-chlorophenyl)-
- 2-Bromo-N-(4-chlorophenyl)butanamide
- Butyranilide, 2-bromo-4′-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.