CAS 90841-19-3

3-(4-Bromophenyl)-2-piperazinone

Description:

3-(4-Bromophenyl)-2-piperazinone is a chemical compound characterized by its piperazinone structure, which includes a piperazine ring substituted with a bromophenyl group. This compound typically exhibits a molecular formula that reflects the presence of bromine, nitrogen, and carbon atoms, contributing to its unique properties. It is often utilized in medicinal chemistry and pharmacological research due to its potential biological activity, particularly in the development of psychoactive drugs and other therapeutic agents. The presence of the bromine atom enhances its lipophilicity, which can influence its interaction with biological targets. Additionally, the piperazinone moiety is known for its ability to form hydrogen bonds, which can affect the compound's solubility and reactivity. As with many organic compounds, its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₀H₁₁BrN₂O

InChI: InChI=1S/C10H11BrN2O/c11-8-3-1-7(2-4-8)9-10(14)13-6-5-12-9/h1-4,9,12H,5-6H2,(H,13,14)

InChI key: InChIKey=CQRGSJDXPCSHAJ-UHFFFAOYSA-N

SMILES: O=C1C(C2=CC=C(Br)C=C2)NCCN1

Synonyms:

• 2-Piperazinone, 3-(p-bromophenyl)-
• 3-(4-Bromophenyl)-2-piperazinone
• 2-Piperazinone, 3-(4-bromophenyl)-

3-(4-Bromophenyl)piperazin-2-one

CAS: 90841-19-3

Versatile small molecule scaffold

Formula: C₁₀H₁₁BrN₂O

Purity: Min. 95%

Molecular weight: 255.11 g/mol

Ref: 3D-QDA84119