CymitQuimica logo

CAS 90841-55-7

:

benzyl 3-bromopropanoate

Description:
Benzyl 3-bromopropanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of benzyl alcohol and 3-bromopropanoic acid. It typically appears as a colorless to pale yellow liquid with a pleasant aromatic odor. The compound is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic benzyl group. Its molecular structure features a bromine atom attached to the propanoate chain, which can influence its reactivity and potential applications in organic synthesis. Benzyl 3-bromopropanoate can serve as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate measures should be taken to avoid skin and eye contact.
Formula:C10H11BrO2
InChI:InChI=1/C10H11BrO2/c11-7-6-10(12)13-8-9-4-2-1-3-5-9/h1-5H,6-8H2
InChI key:QJKVDFRAKMVERC-UHFFFAOYSA-N
SMILES:c1ccc(cc1)COC(=O)CCBr
Found 4 products.