CAS 90842-92-5
:4-(prop-2-en-1-yl)-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol
Description:
4-(Prop-2-en-1-yl)-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a thiol (-SH) group, which contributes to its reactivity and potential applications in various chemical reactions, including as a ligand in coordination chemistry. The presence of the pyridine moiety enhances its solubility in polar solvents and may influence its biological activity, making it of interest in medicinal chemistry. The alkenyl group (prop-2-en-1-yl) suggests potential for further chemical modifications through reactions such as polymerization or cross-coupling. This compound may exhibit properties such as antimicrobial or antifungal activity, which are common in triazole derivatives. Its unique structure allows for diverse applications in pharmaceuticals, agrochemicals, and materials science. As with many chemical substances, safety and handling precautions should be observed due to the presence of the thiol group, which can be reactive and may have specific toxicity profiles.
Formula:C10H10N4S
InChI:InChI=1/C10H10N4S/c1-2-7-14-9(12-13-10(14)15)8-3-5-11-6-4-8/h2-6H,1,7H2,(H,13,15)
SMILES:C=CCn1c(c2ccncc2)nnc1S
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
