CAS 90843-37-1

methyl (2E)-3-(4-sulfanylphenyl)prop-2-enoate

Description:

Methyl (2E)-3-(4-sulfanylphenyl)prop-2-enoate, identified by its CAS number 90843-37-1, is an organic compound characterized by its ester functional group and a conjugated double bond system. This compound features a methyl ester derived from a prop-2-enoic acid, with a phenyl group substituted at the 3-position, which contains a sulfanyl (thiol) group at the para position. The presence of the sulfanyl group imparts unique chemical reactivity, making it a potential candidate for various chemical transformations and applications in organic synthesis. The conjugated double bond system contributes to its potential for UV absorption and reactivity in electrophilic addition reactions. Additionally, the compound may exhibit interesting biological properties due to the presence of the thiol group, which is known for its role in redox chemistry and interactions with biological molecules. Overall, methyl (2E)-3-(4-sulfanylphenyl)prop-2-enoate is a versatile compound with potential applications in pharmaceuticals, agrochemicals, and materials science.

Formula: C₁₀H₁₀O₂S

InChI: InChI=1/C10H10O2S/c1-12-10(11)7-4-8-2-5-9(13)6-3-8/h2-7,13H,1H3/b7-4+