CymitQuimica logo

CAS 908494-81-5

:

3-chloro-N-(3-fluoro-4-methylphenyl)propanamide

Description:
3-Chloro-N-(3-fluoro-4-methylphenyl)propanamide is a chemical compound characterized by its amide functional group, which is formed by the reaction of a carboxylic acid and an amine. This compound features a propanamide backbone with a chlorine atom at the third carbon position and a substituted aromatic ring containing a fluorine atom and a methyl group. The presence of the chlorine and fluorine substituents contributes to its potential biological activity and lipophilicity, influencing its solubility and reactivity. The compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be affected by the presence of the halogen substituents. It may be of interest in pharmaceutical research due to its structural characteristics, which could impart specific interactions with biological targets. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks. As with any chemical, proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is essential for confirming its identity and purity.
Formula:C10H11ClFNO
InChI:InChI=1/C10H11ClFNO/c1-7-2-3-8(6-9(7)12)13-10(14)4-5-11/h2-3,6H,4-5H2,1H3,(H,13,14)
SMILES:Cc1ccc(cc1F)N=C(CCCl)O
Synonyms:
  • propanamide, 3-chloro-N-(3-fluoro-4-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.