CymitQuimica logo

CAS 908494-83-7

:

3-chloro-N-(5-fluoro-2-methylphenyl)propanamide

Description:
3-Chloro-N-(5-fluoro-2-methylphenyl)propanamide is a chemical compound characterized by its amide functional group, which is formed from the reaction of a carboxylic acid and an amine. This compound features a propanamide backbone, with a chlorine atom at the third carbon position and a 5-fluoro-2-methylphenyl group attached to the nitrogen atom. The presence of the chlorine and fluorine substituents contributes to its potential biological activity and lipophilicity, which may influence its solubility and reactivity. The molecular structure suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the halogen substituents. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogens, which can pose environmental and health risks. Overall, this compound's unique structure may provide avenues for research in pharmaceuticals or agrochemicals.
Formula:C10H11ClFNO
InChI:InChI=1/C10H11ClFNO/c1-7-2-3-8(12)6-9(7)13-10(14)4-5-11/h2-3,6H,4-5H2,1H3,(H,13,14)
SMILES:Cc1ccc(cc1N=C(CCCl)O)F
Synonyms:
  • propanamide, 3-chloro-N-(5-fluoro-2-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.