CAS 908494-85-9

5-bromo-N-propylthiophene-2-carboxamide

Description:

5-Bromo-N-propylthiophene-2-carboxamide is a chemical compound characterized by its unique structure, which includes a thiophene ring substituted with a bromine atom and a propyl group, along with a carboxamide functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various solvents. The presence of the bromine atom may enhance its electrophilic character, making it useful in various synthetic applications, including medicinal chemistry and materials science. The carboxamide group can participate in hydrogen bonding, influencing its physical properties such as melting point and solubility. Additionally, the thiophene moiety is known for its electronic properties, which can be beneficial in applications like organic electronics and photonics. Overall, 5-bromo-N-propylthiophene-2-carboxamide is a versatile compound with potential applications in research and industry, particularly in the development of new materials and pharmaceuticals.

Formula: C₈H₁₀BrNOS

InChI: InChI=1/C8H10BrNOS/c1-2-5-10-8(11)6-3-4-7(9)12-6/h3-4H,2,5H2,1H3,(H,10,11)

SMILES: CCCNC(=O)c1ccc(Br)s1

Synonyms:

• 2-thiophenecarboxamide, 5-bromo-N-propyl-