CAS 908518-19-4

5-bromo-N-ethylthiophene-2-carboxamide

Description:

5-Bromo-N-ethylthiophene-2-carboxamide is a chemical compound characterized by its unique structure, which includes a thiophene ring substituted with a bromine atom and an ethyl group attached to the nitrogen of the amide functional group. This compound is typically used in organic synthesis and may serve as an intermediate in the development of pharmaceuticals or agrochemicals. The presence of the bromine atom enhances its reactivity, making it suitable for various chemical transformations. The thiophene ring contributes to its aromatic properties, which can influence its electronic characteristics and solubility in different solvents. Additionally, the carboxamide functional group can participate in hydrogen bonding, affecting its physical properties such as melting point and solubility. Overall, 5-bromo-N-ethylthiophene-2-carboxamide is a versatile compound with potential applications in medicinal chemistry and materials science, owing to its distinctive structural features and reactivity.

Formula: C₇H₈BrNOS

InChI: InChI=1/C7H8BrNOS/c1-2-9-7(10)5-3-4-6(8)11-5/h3-4H,2H2,1H3,(H,9,10)

SMILES: CCNC(=O)c1ccc(Br)s1

Synonyms:

• 2-thiophenecarboxamide, 5-bromo-N-ethyl-