CAS 908518-25-2
:4-[(2-Chloroacetyl)amino]-N-cyclopentylbenzamide
Description:
4-[(2-Chloroacetyl)amino]-N-cyclopentylbenzamide, identified by its CAS number 908518-25-2, is a chemical compound characterized by its amide functional group, which is indicative of its potential biological activity. The presence of a chloroacetyl group suggests that it may exhibit reactivity typical of acylating agents, potentially influencing its interactions with biological macromolecules. The cyclopentyl group contributes to its hydrophobic character, which can affect its solubility and permeability in biological systems. This compound may be of interest in medicinal chemistry due to its structural features that could facilitate interactions with specific biological targets, making it a candidate for further investigation in drug development. Its molecular structure likely influences its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME). Additionally, the presence of chlorine in the structure may impart unique reactivity or biological activity, warranting further study to elucidate its mechanism of action and potential therapeutic applications.
Formula:C14H17ClN2O2
InChI:InChI=1S/C14H17ClN2O2/c15-9-13(18)16-12-7-5-10(6-8-12)14(19)17-11-3-1-2-4-11/h5-8,11H,1-4,9H2,(H,16,18)(H,17,19)
InChI key:InChIKey=INHMORNABGFORD-UHFFFAOYSA-N
SMILES:C(NC1CCCC1)(=O)C2=CC=C(NC(CCl)=O)C=C2
Synonyms:- 4-[(2-Chloroacetyl)amino]-N-cyclopentylbenzamide
- Benzamide, 4-[(chloroacetyl)amino]-N-cyclopentyl-
- Benzamide, 4-[(2-chloroacetyl)amino]-N-cyclopentyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.