CAS 908518-29-6
:2-Chloro-N-[4-(1-pyrrolidinylcarbonyl)phenyl]acetamide
Description:
2-Chloro-N-[4-(1-pyrrolidinylcarbonyl)phenyl]acetamide, with the CAS number 908518-29-6, is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro substituent, an acetamide moiety, and a phenyl ring that is further substituted with a pyrrolidinylcarbonyl group. This compound is typically classified as an amide due to the presence of the acetamide functional group, which is known for its ability to participate in hydrogen bonding, influencing its solubility and reactivity. The presence of the chloro group can enhance its electrophilic character, making it potentially reactive in various chemical reactions. Additionally, the pyrrolidinyl group may impart specific biological activities, suggesting potential applications in medicinal chemistry. The compound's molecular structure indicates it may exhibit unique physical and chemical properties, such as melting point, boiling point, and solubility, which are essential for its application in research and industry. Overall, this compound's characteristics make it of interest in various fields, including pharmaceuticals and organic synthesis.
Formula:C13H15ClN2O2
InChI:InChI=1S/C13H15ClN2O2/c14-9-12(17)15-11-5-3-10(4-6-11)13(18)16-7-1-2-8-16/h3-6H,1-2,7-9H2,(H,15,17)
InChI key:InChIKey=KAOSIVGXRNZEQY-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(NC(CCl)=O)C=C1)N2CCCC2
Synonyms:- Acetamide, 2-chloro-N-[4-(1-pyrrolidinylcarbonyl)phenyl]-
- 2-Chloro-N-[4-(1-pyrrolidinylcarbonyl)phenyl]acetamide
- 2-chloro-N-(4-pyrrolidin-1-ylcarbonylphenyl)ethanamide
- 2-CHLORO-N-[4-(PYRROLIDIN-1-YLCARBONYL)PHENYL]ACETAMIDE
- 2-chloro-N-[4-(oxo-1-pyrrolidinylmethyl)phenyl]acetamide
- 2-chloro-N-[4-(pyrrolidine-1-carbonyl)phenyl]acetamide
- IVK/0028604
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.