CAS 908518-31-0
:4-[(2-Chloroacetyl)amino]-N-(1-methylethyl)benzamide
Description:
4-[(2-Chloroacetyl)amino]-N-(1-methylethyl)benzamide, with the CAS number 908518-31-0, is a chemical compound that belongs to the class of amides. It features a benzamide structure, which is characterized by the presence of a benzene ring attached to a carbonyl group (C=O) and an amine group (NH2). The compound contains a chloroacetyl group, which introduces a chlorine atom and an acetyl moiety, enhancing its reactivity and potential biological activity. The presence of the isopropyl group (1-methylethyl) contributes to its steric properties, potentially influencing its interaction with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many chemical substances, safety precautions should be taken when handling it, and its properties should be evaluated in the context of its intended use, particularly in research and pharmaceutical applications.
Formula:C12H15ClN2O2
InChI:InChI=1S/C12H15ClN2O2/c1-8(2)14-12(17)9-3-5-10(6-4-9)15-11(16)7-13/h3-6,8H,7H2,1-2H3,(H,14,17)(H,15,16)
InChI key:InChIKey=DJRIJPRDWHELQD-UHFFFAOYSA-N
SMILES:C(NC(C)C)(=O)C1=CC=C(NC(CCl)=O)C=C1
Synonyms:- Benzamide, 4-[(chloroacetyl)amino]-N-(1-methylethyl)-
- Benzamide, 4-[(2-chloroacetyl)amino]-N-(1-methylethyl)-
- 4-[(2-Chloroacetyl)amino]-N-(1-methylethyl)benzamide
- 4-[(CHLOROACETYL)AMINO]-N-ISOPROPYLBENZAMIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.