CAS 908598-58-3
:N-[(1R,2R)-2-{[(1R)-1-(naphthalen-1-yl)ethyl]amino}cyclohexyl]-4-nitrobenzenesulfonamide
Description:
N-[(1R,2R)-2-{[(1R)-1-(naphthalen-1-yl)ethyl]amino}cyclohexyl]-4-nitrobenzenesulfonamide, with CAS number 908598-58-3, is a chemical compound characterized by its complex structure, which includes a sulfonamide functional group, a nitro group, and a naphthalene moiety. This compound features a chiral center, contributing to its stereochemistry, which is significant for its biological activity. The presence of the sulfonamide group suggests potential applications in medicinal chemistry, particularly as an antibacterial or anti-inflammatory agent. The nitro group may also influence the compound's reactivity and pharmacological properties. Additionally, the naphthalene ring can enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. Overall, this compound's unique structural features may contribute to its efficacy in various therapeutic contexts, making it a subject of interest in drug development and research.
Formula:C24H27N3O4S
InChI:InChI=1/C24H27N3O4S/c1-17(21-10-6-8-18-7-2-3-9-22(18)21)25-23-11-4-5-12-24(23)26-32(30,31)20-15-13-19(14-16-20)27(28)29/h2-3,6-10,13-17,23-26H,4-5,11-12H2,1H3/t17-,23-,24-/m1/s1
SMILES:C[C@H](c1cccc2ccccc12)N[C@@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(cc1)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-[(1R,2R)-2-[[(1R)-1-(1-Naphthyl)ethyl]amino]cyclohexyl]-4-nitrobenzenesulfonamide
CAS:Controlled ProductApplications N-[(1R,2R)-2-[[(1R)-1-(1-Naphthyl)ethyl]amino]cyclohexyl]_x000D_-4-nitrobenzenesulfonamide (cas# 908598-58-3) is a compound useful in organic synthesis.
Formula:C24H27N3O4SColor and Shape:NeatMolecular weight:453.55
