CymitQuimica logo

CAS 908600-74-8

:

5-Fluoro-1H-indole-6-carboxylic acid

Description:
5-Fluoro-1H-indole-6-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 5-position and a carboxylic acid group at the 6-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids. Its molecular structure allows for potential interactions in biological systems, making it of interest in pharmaceutical research, particularly in the development of compounds with antimicrobial or anticancer properties. The carboxylic acid functional group can participate in hydrogen bonding, influencing its reactivity and solubility. Additionally, the fluorine substitution can enhance lipophilicity and metabolic stability, which are important factors in drug design. Overall, 5-Fluoro-1H-indole-6-carboxylic acid serves as a valuable building block in organic synthesis and medicinal chemistry.
Formula:C9H6FNO2
InChI:InChI=1S/C9H6FNO2/c10-7-3-5-1-2-11-8(5)4-6(7)9(12)13/h1-4,11H,(H,12,13)
InChI key:InChIKey=WRWGWOQVFRKLAB-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C2C(=CC1F)C=CN2
Synonyms:
  • 1H-Indole-6-carboxylic acid, 5-fluoro-
  • 5-Fluoro-1H-indole-6-carboxylic acid
Found 3 products.