CAS 908600-78-2
:5-Chloro-6-fluoro-1H-indole-4-carboxylic acid
Description:
5-Chloro-6-fluoro-1H-indole-4-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of chlorine and fluorine substituents at the 5 and 6 positions, respectively, enhances its chemical properties, potentially influencing its biological activity and solubility. The compound is likely to exhibit polar characteristics due to the carboxylic acid group, making it soluble in polar solvents. Additionally, the halogen substituents may impart unique electronic properties, affecting its reactivity in various chemical reactions. This compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to the indole moiety's prevalence in biologically active compounds. As with many chemical substances, safety and handling precautions should be observed, given the potential hazards associated with halogenated compounds.
Formula:C9H5ClFNO2
InChI:InChI=1S/C9H5ClFNO2/c10-8-5(11)3-6-4(1-2-12-6)7(8)9(13)14/h1-3,12H,(H,13,14)
InChI key:InChIKey=GIRQBZKCLHCVMA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=CC(F)=C1Cl)NC=C2
Synonyms:- 1H-Indole-4-carboxylic acid, 5-chloro-6-fluoro-
- 5-Chloro-6-fluoro-1H-indole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
