CAS 908600-79-3
:5-Chloro-4-fluoro-1H-indole-6-carboxylic acid
Description:
5-Chloro-4-fluoro-1H-indole-6-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular indole derivative features a carboxylic acid functional group at the 6-position, a chlorine atom at the 5-position, and a fluorine atom at the 4-position. The presence of these halogen substituents can influence the compound's reactivity, solubility, and biological activity. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The carboxylic acid group contributes to its acidity and potential for forming salts or esters. Additionally, the specific arrangement of substituents can affect the compound's electronic properties and steric hindrance, which are crucial for interactions with biological targets. Overall, 5-Chloro-4-fluoro-1H-indole-6-carboxylic acid is a valuable compound in research, particularly in the fields of drug discovery and development.
Formula:C9H5ClFNO2
InChI:InChI=1S/C9H5ClFNO2/c10-7-5(9(13)14)3-6-4(8(7)11)1-2-12-6/h1-3,12H,(H,13,14)
InChI key:InChIKey=LOKRKKWFNLRBMP-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC(C(O)=O)=C1Cl)NC=C2
Synonyms:- 5-Chloro-4-fluoro-1H-indole-6-carboxylic acid
- 1H-Indole-6-carboxylic acid, 5-chloro-4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
