
CAS 90868-33-0
:2,6-Dimethyl-4-nitrobenzamide
Description:
2,6-Dimethyl-4-nitrobenzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methyl groups and a nitro group, along with an amide functional group. The presence of the nitro group contributes to its potential reactivity and polarity, while the methyl groups can influence its steric properties and solubility. This compound typically appears as a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Due to the presence of the nitro group, it may also exhibit some degree of toxicity and should be handled with care in laboratory settings. Overall, 2,6-Dimethyl-4-nitrobenzamide is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals.
Formula:C9H10N2O3
InChI:InChI=1S/C9H10N2O3/c1-5-3-7(11(13)14)4-6(2)8(5)9(10)12/h3-4H,1-2H3,(H2,10,12)
InChI key:InChIKey=JRSUYYPCWGNDAS-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(C)C=C(N(=O)=O)C=C1C
Synonyms:- Benzamide, 2,6-dimethyl-4-nitro-
- 2,6-Dimethyl-4-nitrobenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.