CAS 90871-42-4
:4-isopropyl-5-(3-pyridyl)-1,2,4-triazole-3-thiol
Description:
4-Isopropyl-5-(3-pyridyl)-1,2,4-triazole-3-thiol is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocycle containing three nitrogen atoms. This compound features an isopropyl group and a pyridine moiety, contributing to its unique properties and potential biological activity. The presence of the thiol (-SH) functional group indicates that it can participate in redox reactions and may exhibit antioxidant properties. This compound is often studied for its potential applications in agriculture, particularly as a fungicide or herbicide, due to its ability to inhibit specific enzymes or metabolic pathways in target organisms. Additionally, its structural features suggest that it may interact with various biological targets, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary depending on environmental conditions, such as pH and temperature, which are important considerations for its practical applications. Overall, 4-isopropyl-5-(3-pyridyl)-1,2,4-triazole-3-thiol represents a versatile compound with potential utility in both agricultural and pharmaceutical contexts.
Formula:C10H12N4S
InChI:InChI=1/C10H12N4S/c1-7(2)14-9(12-13-10(14)15)8-4-3-5-11-6-8/h3-7H,1-2H3,(H,13,15)
SMILES:CC(C)n1c(c2cccnc2)nnc1S
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.