CAS 90871-45-7
:2,4-Dihydro-4-propyl-5-(4-pyridinyl)-3H-1,2,4-triazole-3-thione
Description:
2,4-Dihydro-4-propyl-5-(4-pyridinyl)-3H-1,2,4-triazole-3-thione, with CAS number 90871-45-7, is a chemical compound that belongs to the class of triazoles, which are five-membered heterocyclic compounds containing three nitrogen atoms. This particular triazole derivative features a thione functional group, which is characterized by the presence of a sulfur atom double-bonded to a carbon atom. The compound exhibits a propyl group and a pyridine ring, contributing to its potential biological activity and solubility properties. It is often studied for its fungicidal and herbicidal applications, particularly in agricultural chemistry. The presence of the pyridine moiety may enhance its interaction with biological targets, making it of interest in medicinal chemistry as well. The compound's stability, solubility, and reactivity can vary based on environmental conditions, and it may undergo various chemical transformations. As with many triazole derivatives, it may also exhibit specific pharmacological properties, warranting further investigation into its potential uses in various fields.
Formula:C10H12N4S
InChI:InChI=1S/C10H12N4S/c1-2-7-14-9(12-13-10(14)15)8-3-5-11-6-4-8/h3-6H,2,7H2,1H3,(H,13,15)
InChI key:InChIKey=LZRLGHCSTYKCRQ-UHFFFAOYSA-N
SMILES:C(CC)N1C(=NNC1=S)C=2C=CN=CC2
Synonyms:- 2,4-Dihydro-4-propyl-5-(4-pyridinyl)-3H-1,2,4-triazole-3-thione
- 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-4-propyl-5-(4-pyridinyl)-
- 4-Propyl-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol
- 4-propyl-3-(4-pyridyl)-4,5-dihydro-1H-1,2,4-triazole-5-thione
- 4H-1,2,4-Triazole-3-thiol, 4-propyl-5-(4-pyridinyl)-
- 4H-1,2,4-Triazole-3-thiol, 4-propyl-5-(4-pyridyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.