CAS 90874-51-4

1H-Inden-1-amine, 2,3-dihydro-6-methyl-, hydrochloride (1:1)

Description:

1H-Inden-1-amine, 2,3-dihydro-6-methyl-, hydrochloride (1:1), with the CAS number 90874-51-4, is a chemical compound characterized by its structure, which includes an indene ring system with an amine functional group. This compound is a hydrochloride salt, indicating that it is typically encountered in a protonated form, enhancing its solubility in water. The presence of the methyl group at the 6-position of the indene structure contributes to its unique chemical properties and potential biological activity. As an amine, it may exhibit basicity and can participate in various chemical reactions, including nucleophilic substitutions and complexation with acids. The compound's hydrochloride form is often utilized in pharmaceutical applications, where it may serve as an intermediate or active ingredient. Its specific characteristics, such as melting point, solubility, and reactivity, can vary based on the conditions and the presence of other substances. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.

Formula: C₁₀H₁₃N·ClH

InChI: InChI=1S/C10H13N.ClH/c1-7-2-3-8-4-5-10(11)9(8)6-7;/h2-3,6,10H,4-5,11H2,1H3;1H

InChI key: InChIKey=KEMDEHSGFBNQOZ-UHFFFAOYSA-N

SMILES: NC1C=2C(=CC=C(C)C2)CC1.Cl

Synonyms:

• 1-Indanamine, 6-methyl-, hydrochloride
• 1H-Inden-1-amine, 2,3-dihydro-6-methyl-, hydrochloride (1:1)

6-Methyl-2,3-dihydro-1h-inden-1-amine hydrochloride

CAS: 90874-51-4

Formula: C₁₀H₁₄ClN

Purity: 95%

Molecular weight: 183.6779

Ref: IN-DA01AB96

6-Methyl-2,3-dihydro-1h-inden-1-amine hydrochloride

CAS: 90874-51-4

6-Methyl-2,3-dihydro-1h-inden-1-amine hydrochloride

Purity: 95%

Molecular weight: 183.68g/mol

Ref: 54-OR78222

6-Methyl-2,3-dihydro-1h-inden-1-amine hydrochloride

CAS: 90874-51-4

Purity: 95%

Molecular weight: 183.6799927

Ref: 10-F699323