CymitQuimica logo

CAS 908847-02-9

:

3-(Phenylmethyl)-1H-pyrrolo[2,3-c]pyridine

Description:
3-(Phenylmethyl)-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of the phenylmethyl group enhances its aromatic character and may influence its reactivity and solubility. This compound typically exhibits moderate to high lipophilicity due to its aromatic structure, which can affect its biological activity and potential applications in medicinal chemistry. It may interact with various biological targets, making it of interest in drug discovery and development. The compound's molecular structure suggests potential for diverse chemical reactions, including electrophilic substitutions and nucleophilic attacks, depending on the functional groups present. Additionally, its stability and reactivity can be influenced by the electronic effects of the phenylmethyl substituent. Overall, 3-(Phenylmethyl)-1H-pyrrolo[2,3-c]pyridine represents a class of compounds that may possess significant pharmacological properties, warranting further investigation in the context of therapeutic applications.
Formula:C14H12N2
InChI:InChI=1S/C14H12N2/c1-2-4-11(5-3-1)8-12-9-16-14-10-15-7-6-13(12)14/h1-7,9-10,16H,8H2
InChI key:InChIKey=NZIHACXNHLITIL-UHFFFAOYSA-N
SMILES:C(C=1C=2C(NC1)=CN=CC2)C3=CC=CC=C3
Synonyms:
  • 3-(Phenylmethyl)-1H-pyrrolo[2,3-c]pyridine
  • 1H-Pyrrolo[2,3-c]pyridine, 3-(phenylmethyl)-
  • 3-Benzyl-6-azaindole
  • 3-Benzyl-1H-pyrrolo[2,3-c]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.