CAS 909036-46-0

2-chloro-3-iodo-pyridin-4-amine

Description:

2-Chloro-3-iodo-pyridin-4-amine is a heterocyclic organic compound characterized by a pyridine ring substituted with both a chlorine and an iodine atom, as well as an amino group. The presence of these halogen substituents can significantly influence the compound's reactivity and properties, making it of interest in various chemical applications, including medicinal chemistry and material science. The amino group contributes to the compound's potential as a nucleophile, while the halogens can participate in electrophilic aromatic substitution reactions. This compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its molecular structure suggests potential for interactions with biological targets, which may be explored in drug development. Additionally, the compound's unique combination of functional groups may impart specific electronic and steric properties, influencing its behavior in chemical reactions and interactions with other molecules. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₅H₄ClIN₂

InChI: InChI=1/C5H4ClIN2/c6-5-4(7)3(8)1-2-9-5/h1-2H,(H2,8,9)

SMILES: c1cnc(c(c1N)I)Cl

Synonyms:

• 2-Chloro-3-Iodopyridin-4-Amine
• 4-Pyridinamine, 2-chloro-3-iodo-

2-Chloro-3-iodopyridin-4-amine

CAS: 909036-46-0

Formula: C₅H₄ClIN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 254.4561

Ref: IN-DA0038JR

4-Amino-2-chloro-3-iodopyridine

CAS: 909036-46-0

4-Amino-2-chloro-3-iodopyridine

Formula: C₅H₄ClIN₂

Purity: 95%

Color and Shape: white to off-white crystalline solid

Molecular weight: 254.46g/mol

Ref: 54-OR42029

2-Chloro-3-iodopyridin-4-amine

CAS: 909036-46-0

Formula: C₅H₄ClIN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 254.46

Ref: 10-F217630