CAS 90904-35-1

Ethyl 2,6-dihydroxy-4-methylbenzoate

Description:

Ethyl 2,6-dihydroxy-4-methylbenzoate, with the CAS number 90904-35-1, is an organic compound that belongs to the class of benzoates. It features a benzoic acid derivative structure, characterized by the presence of two hydroxyl (-OH) groups at the 2 and 6 positions and a methyl group at the 4 position of the aromatic ring. The ethyl ester functional group is attached to the carboxylic acid moiety, enhancing its solubility in organic solvents. This compound is typically a white to off-white solid and is known for its potential applications in the fields of pharmaceuticals and cosmetics, often serving as an intermediate in the synthesis of various bioactive compounds. Its hydroxyl groups contribute to its reactivity and ability to form hydrogen bonds, which can influence its solubility and interaction with biological systems. Additionally, the presence of the methyl group may affect its steric properties and overall stability. As with many organic compounds, safety data should be consulted for handling and usage guidelines.

Formula: C₁₀H₁₂O₄

InChI: InChI=1S/C10H12O4/c1-3-14-10(13)9-7(11)4-6(2)5-8(9)12/h4-5,11-12H,3H2,1-2H3

InChI key: InChIKey=HEYUNNVBQQMDPI-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(O)C=C(C)C=C1O

Synonyms:

• Ethyl 2,6-dihydroxy-4-methylbenzoate
• Ethyl p-orsellinate
• Benzoic acid, 2,6-dihydroxy-4-methyl-, ethyl ester