CAS 909092-64-4

5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxylic acid

Description:

5-(5-Methylfuran-2-yl)-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a furan moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the 5-methylfuran substituent enhances its potential for various chemical interactions, making it of interest in medicinal chemistry and organic synthesis. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the furan and pyrazole rings may contribute to its aromatic character and stability. Additionally, the compound may participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. Its specific applications can vary, but it may be explored for use in pharmaceuticals or as a building block in organic synthesis. As with many organic compounds, safety data should be consulted for handling and usage guidelines.

Formula: C₉H₈N₂O₃

InChI: InChI=1/C9H8N2O3/c1-5-2-3-8(14-5)6-4-7(9(12)13)11-10-6/h2-4H,1H3,(H,10,11)(H,12,13)

SMILES: Cc1ccc(c2cc(C(=O)O)n[nH]2)o1

Synonyms:

• 1H-Pyrazole-5-carboxylic acid, 3-(5-methyl-2-furanyl)-
• 3-(5-Methyl-2-furyl)-1H-pyrazole-5-carboxylic acid